C15H24O2 — CID 5374651
4-[(1E,5E)-2,6,8-trimethylnona-1,5-dienyl]oxetan-2-one (PubChem CID 5374651) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 4-[(1E,5E)-2,6,8-trimethylnona-1,5-dienyl]oxetan-2-one.
| Compound Name | 4-[(1E,5E)-2,6,8-trimethylnona-1,5-dienyl]oxetan-2-one |
|---|---|
| PubChem CID | 5374651 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 4-[(1E,5E)-2,6,8-trimethylnona-1,5-dienyl]oxetan-2-one |
| SMILES | C/C(=C\C1CC(=O)O1)CC/C=C(\C)CC(C)C |
| InChI | InChI=1S/C15H24O2/c1-11(2)8-12(3)6-5-7-13(4)9-14-10-15(16)17-14/h6,9,11,14H,5,7-8,10H2,1-4H3/b12-6+,13-9+ |
| InChIKey | ORDKFPCMUNXMSK-IWFZMGPQSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|