About [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate
[(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate (PubChem CID 6437648) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate.
Molecular Properties
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate |
| PubChem CID | 6437648 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H26O2/c1-6-14(5)15(16)17-11-10-13(4)9-7-8-12(2)3/h8,10,14H,6-7,9,11H2,1-5H3/b13-10+ |
| InChIKey | PEQMAZJTEUEQJP-JLHYYAGUSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate?
The IUPAC name of [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate (CID 6437648) is [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate.
What is the SMILES notation for [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate?
The canonical SMILES for [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate is CCC(C)C(=O)OC/C=C(\C)CCC=C(C)C.
What is the InChIKey of [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate?
The InChIKey is PEQMAZJTEUEQJP-JLHYYAGUSA-N. The full InChI is InChI=1S/C15H26O2/c1-6-14(5)15(16)17-11-10-13(4)9-7-8-12(2)3/h8,10,14H,6-7,9,11H2,1-5H3/b13-10+.
What are the key properties of [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate?
[(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate has a molecular weight of 238.37 g/mol, XLogP of 4.27, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-3,7-dimethylocta-2,6-dienyl] 2-methylbutanoate is sourced from PubChem (CID 6437648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).