C22H23NO8 — CID 5374948
dimethyl 1-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-2,5-dimethyl-1-benzazepine-3,4-dicarboxylate (PubChem CID 5374948) has the molecular formula C22H23NO8 and a molecular weight of 429.43 g/mol. Its IUPAC name is dimethyl 1-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-2,5-dimethyl-1-benzazepine-3,4-dicarboxylate.
| Compound Name | dimethyl 1-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-2,5-dimethyl-1-benzazepine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 5374948 |
| Molecular Formula | C22H23NO8 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | dimethyl 1-[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-2,5-dimethyl-1-benzazepine-3,4-dicarboxylate |
| SMILES | COC(=O)/C=C(\C(=O)OC)N1C(C)=C(C(=O)OC)C(C(=O)OC)=C(C)c2ccccc21 |
| InChI | InChI=1S/C22H23NO8/c1-12-14-9-7-8-10-15(14)23(16(20(25)29-4)11-17(24)28-3)13(2)19(22(27)31-6)18(12)21(26)30-5/h7-11H,1-6H3/b16-11+ |
| InChIKey | KRPIEYXZXCLMNT-LFIBNONCSA-N |
| XLogP | 2.13 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|