C23H24F3NO4 — CID 5375170
ethyl (E)-5-phenyl-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate (PubChem CID 5375170) has the molecular formula C23H24F3NO4 and a molecular weight of 435.44 g/mol. Its IUPAC name is ethyl (E)-5-phenyl-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate.
| Compound Name | ethyl (E)-5-phenyl-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate |
|---|---|
| PubChem CID | 5375170 |
| Molecular Formula | C23H24F3NO4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | ethyl (E)-5-phenyl-4-[(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)amino]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C(Cc1ccccc1)NC(=O)C(OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H24F3NO4/c1-3-31-20(28)15-14-19(16-17-10-6-4-7-11-17)27-21(29)22(30-2,23(24,25)26)18-12-8-5-9-13-18/h4-15,19H,3,16H2,1-2H3,(H,27,29)/b15-14+ |
| InChIKey | RDFAHLYDJOBRLZ-CCEZHUSRSA-N |
| XLogP | 3.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|