C15H24O2 — CID 5375296
1-[1-methoxy-3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclopentyl]ethanone (PubChem CID 5375296) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 1-[1-methoxy-3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclopentyl]ethanone.
| Compound Name | 1-[1-methoxy-3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclopentyl]ethanone |
|---|---|
| PubChem CID | 5375296 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1-[1-methoxy-3,3-dimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclopentyl]ethanone |
| SMILES | C=C(C)/C=C/C1C(C)(C)CCC1(OC)C(C)=O |
| InChI | InChI=1S/C15H24O2/c1-11(2)7-8-13-14(4,5)9-10-15(13,17-6)12(3)16/h7-8,13H,1,9-10H2,2-6H3/b8-7+ |
| InChIKey | JAHGFBJTIDFFAM-BQYQJAHWSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|