C17H13F4NO4 — CID 5378789
dimethyl (Z)-2-[methyl-(5,6,7,8-tetrafluoronaphthalen-1-yl)amino]but-2-enedioate (PubChem CID 5378789) has the molecular formula C17H13F4NO4 and a molecular weight of 371.29 g/mol. Its IUPAC name is dimethyl (Z)-2-[methyl-(5,6,7,8-tetrafluoronaphthalen-1-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (Z)-2-[methyl-(5,6,7,8-tetrafluoronaphthalen-1-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 5378789 |
| Molecular Formula | C17H13F4NO4 |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | dimethyl (Z)-2-[methyl-(5,6,7,8-tetrafluoronaphthalen-1-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/C(=O)OC)N(C)c1cccc2c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C17H13F4NO4/c1-22(10(17(24)26-3)7-11(23)25-2)9-6-4-5-8-12(9)14(19)16(21)15(20)13(8)18/h4-7H,1-3H3/b10-7- |
| InChIKey | DSQZFWNALMEWHU-YFHOEESVSA-N |
| XLogP | 3.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|