C19H16F3NO2 — CID 20667418
methyl 4-methyl-2-[2-(trifluoromethyl)phenyl]-1H-isoquinoline-3-carboxylate (PubChem CID 20667418) has the molecular formula C19H16F3NO2 and a molecular weight of 347.34 g/mol. Its IUPAC name is methyl 4-methyl-2-[2-(trifluoromethyl)phenyl]-1H-isoquinoline-3-carboxylate.
| Compound Name | methyl 4-methyl-2-[2-(trifluoromethyl)phenyl]-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 20667418 |
| Molecular Formula | C19H16F3NO2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | methyl 4-methyl-2-[2-(trifluoromethyl)phenyl]-1H-isoquinoline-3-carboxylate |
| SMILES | COC(=O)C1=C(C)c2ccccc2CN1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H16F3NO2/c1-12-14-8-4-3-7-13(14)11-23(17(12)18(24)25-2)16-10-6-5-9-15(16)19(20,21)22/h3-10H,11H2,1-2H3 |
| InChIKey | QTKKKLWXODWGLA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |