C17H12F2N2O4 — CID 72697900
methyl 2-(2,6-difluoro-4-nitrophenyl)-1H-isoquinoline-3-carboxylate (PubChem CID 72697900) has the molecular formula C17H12F2N2O4 and a molecular weight of 346.29 g/mol. Its IUPAC name is methyl 2-(2,6-difluoro-4-nitrophenyl)-1H-isoquinoline-3-carboxylate.
| Compound Name | methyl 2-(2,6-difluoro-4-nitrophenyl)-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 72697900 |
| Molecular Formula | C17H12F2N2O4 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | methyl 2-(2,6-difluoro-4-nitrophenyl)-1H-isoquinoline-3-carboxylate |
| SMILES | COC(=O)C1=Cc2ccccc2CN1c1c(F)cc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C17H12F2N2O4/c1-25-17(22)15-6-10-4-2-3-5-11(10)9-20(15)16-13(18)7-12(21(23)24)8-14(16)19/h2-8H,9H2,1H3 |
| InChIKey | DSORTRGUDMZVEB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|