C13H19NO2 — CID 5381938
propan-2-yl (3Z)-2-cyano-2,3,5-trimethylhexa-3,5-dienoate (PubChem CID 5381938) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is propan-2-yl (3Z)-2-cyano-2,3,5-trimethylhexa-3,5-dienoate.
| Compound Name | propan-2-yl (3Z)-2-cyano-2,3,5-trimethylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 5381938 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | propan-2-yl (3Z)-2-cyano-2,3,5-trimethylhexa-3,5-dienoate |
| SMILES | C=C(C)/C=C(/C)C(C)(C#N)C(=O)OC(C)C |
| InChI | InChI=1S/C13H19NO2/c1-9(2)7-11(5)13(6,8-14)12(15)16-10(3)4/h7,10H,1H2,2-6H3/b11-7- |
| InChIKey | YTWQJICNKCWVEC-XFFZJAGNSA-N |
| XLogP | 2.99 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|