C15H28O5 — CID 538301
2-tert-butyl-5-(4,4-dimethoxypentyl)-5-methyl-1,3-dioxolan-4-one (PubChem CID 538301) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is 2-tert-butyl-5-(4,4-dimethoxypentyl)-5-methyl-1,3-dioxolan-4-one.
| Compound Name | 2-tert-butyl-5-(4,4-dimethoxypentyl)-5-methyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 538301 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 2-tert-butyl-5-(4,4-dimethoxypentyl)-5-methyl-1,3-dioxolan-4-one |
| SMILES | COC(C)(CCCC1(C)OC(C(C)(C)C)OC1=O)OC |
| InChI | InChI=1S/C15H28O5/c1-13(2,3)12-19-11(16)14(4,20-12)9-8-10-15(5,17-6)18-7/h12H,8-10H2,1-7H3 |
| InChIKey | WXVDYTOHLAOJPQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|