C13H22O5 — CID 101336635
methyl 5-[(2S,4S)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]pentanoate (PubChem CID 101336635) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is methyl 5-[(2S,4S)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]pentanoate.
| Compound Name | methyl 5-[(2S,4S)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]pentanoate |
|---|---|
| PubChem CID | 101336635 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | methyl 5-[(2S,4S)-2-tert-butyl-5-oxo-1,3-dioxolan-4-yl]pentanoate |
| SMILES | COC(=O)CCCC[C@@H]1O[C@H](C(C)(C)C)OC1=O |
| InChI | InChI=1S/C13H22O5/c1-13(2,3)12-17-9(11(15)18-12)7-5-6-8-10(14)16-4/h9,12H,5-8H2,1-4H3/t9-,12-/m0/s1 |
| InChIKey | VGYJQCQJVJEFSH-CABZTGNLSA-N |
| XLogP | 2.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|