C13H24O4 — CID 102354912
[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl heptanoate (PubChem CID 102354912) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl heptanoate.
| Compound Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl heptanoate |
|---|---|
| PubChem CID | 102354912 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl heptanoate |
| SMILES | CCCCCCC(=O)OC[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C13H24O4/c1-4-5-6-7-8-12(14)15-9-11-10-16-13(2,3)17-11/h11H,4-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | WXVNSIYHSSNMHW-LLVKDONJSA-N |
| XLogP | 2.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|