About CID 5383720
CID 5383720 (PubChem CID 5383720) has the molecular formula C5H5N2O2
and a molecular weight of 125.11 g/mol.
Molecular Properties
| Compound Name | CID 5383720 |
| PubChem CID | 5383720 |
| Molecular Formula | C5H5N2O2 |
| Molecular Weight | 125.11 g/mol |
| Exact Mass | 125.04 |
| IUPAC Name | — |
| SMILES | Cn1ccc(=O)nc1[O] |
| InChI | InChI=1S/C5H5N2O2/c1-7-3-2-4(8)6-5(7)9/h2-3H,1H3 |
| InChIKey | QVHSAFZOWIPDOY-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.11 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 5383720 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5383720?
The IUPAC name of CID 5383720 (CID 5383720) is not available.
What is the SMILES notation for CID 5383720?
The canonical SMILES for CID 5383720 is Cn1ccc(=O)nc1[O].
What is the InChIKey of CID 5383720?
The InChIKey is QVHSAFZOWIPDOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N2O2/c1-7-3-2-4(8)6-5(7)9/h2-3H,1H3.
What are the key properties of CID 5383720?
CID 5383720 has a molecular weight of 125.11 g/mol, XLogP of -0.08, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5383720 is sourced from PubChem (CID 5383720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).