C14H25NO — CID 5384601
(1R,4E,8E,12R)-12-(dimethylamino)cyclododeca-4,8-dien-1-ol (PubChem CID 5384601) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (1R,4E,8E,12R)-12-(dimethylamino)cyclododeca-4,8-dien-1-ol.
| Compound Name | (1R,4E,8E,12R)-12-(dimethylamino)cyclododeca-4,8-dien-1-ol |
|---|---|
| PubChem CID | 5384601 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (1R,4E,8E,12R)-12-(dimethylamino)cyclododeca-4,8-dien-1-ol |
| SMILES | CN(C)[C@@H]1CC/C=C/CC/C=C/CC[C@H]1O |
| InChI | InChI=1S/C14H25NO/c1-15(2)13-11-9-7-5-3-4-6-8-10-12-14(13)16/h5-8,13-14,16H,3-4,9-12H2,1-2H3/b7-5+,8-6+/t13-,14-/m1/s1 |
| InChIKey | CGDUEFNENCQIKQ-FOXZPDPLSA-N |
| XLogP | 2.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|