C18H21NO3 — CID 5389028
5,5-dimethyl-2-[(Z)-3-(4-methylanilino)prop-2-enoyl]cyclohexane-1,3-dione (PubChem CID 5389028) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(Z)-3-(4-methylanilino)prop-2-enoyl]cyclohexane-1,3-dione.
| Compound Name | 5,5-dimethyl-2-[(Z)-3-(4-methylanilino)prop-2-enoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 5389028 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 5,5-dimethyl-2-[(Z)-3-(4-methylanilino)prop-2-enoyl]cyclohexane-1,3-dione |
| SMILES | Cc1ccc(N/C=C\C(=O)C2C(=O)CC(C)(C)CC2=O)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-12-4-6-13(7-5-12)19-9-8-14(20)17-15(21)10-18(2,3)11-16(17)22/h4-9,17,19H,10-11H2,1-3H3/b9-8- |
| InChIKey | WLZFCGHZFXJZHX-HJWRWDBZSA-N |
| XLogP | 3.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|