C12H18O4 — CID 538942
(3,3,5-trimethyl-3a,4,7,7a-tetrahydro-1,2-benzodioxol-7-yl) acetate (PubChem CID 538942) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (3,3,5-trimethyl-3a,4,7,7a-tetrahydro-1,2-benzodioxol-7-yl) acetate.
| Compound Name | (3,3,5-trimethyl-3a,4,7,7a-tetrahydro-1,2-benzodioxol-7-yl) acetate |
|---|---|
| PubChem CID | 538942 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (3,3,5-trimethyl-3a,4,7,7a-tetrahydro-1,2-benzodioxol-7-yl) acetate |
| SMILES | CC(=O)OC1C=C(C)CC2C1OOC2(C)C |
| InChI | InChI=1S/C12H18O4/c1-7-5-9-11(15-16-12(9,3)4)10(6-7)14-8(2)13/h6,9-11H,5H2,1-4H3 |
| InChIKey | FCYGVUDTCQPKOV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|