C9H12N2O3S — CID 5389745
(2S)-2-(thiophen-2-ylmethylcarbamoylamino)propanoic acid (PubChem CID 5389745) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is (2S)-2-(thiophen-2-ylmethylcarbamoylamino)propanoic acid.
| Compound Name | (2S)-2-(thiophen-2-ylmethylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 5389745 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (2S)-2-(thiophen-2-ylmethylcarbamoylamino)propanoic acid |
| SMILES | C[C@H](NC(=O)NCc1cccs1)C(=O)O |
| InChI | InChI=1S/C9H12N2O3S/c1-6(8(12)13)11-9(14)10-5-7-3-2-4-15-7/h2-4,6H,5H2,1H3,(H,12,13)(H2,10,11,14)/t6-/m0/s1 |
| InChIKey | IVVJGFLQVZDJEV-LURJTMIESA-N |
| XLogP | 1.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |