C12H18N2O3S2 — CID 663481
methyl (2S)-4-methylsulfanyl-2-(thiophen-2-ylmethylcarbamoylamino)butanoate (PubChem CID 663481) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is methyl (2S)-4-methylsulfanyl-2-(thiophen-2-ylmethylcarbamoylamino)butanoate.
| Compound Name | methyl (2S)-4-methylsulfanyl-2-(thiophen-2-ylmethylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 663481 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | methyl (2S)-4-methylsulfanyl-2-(thiophen-2-ylmethylcarbamoylamino)butanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C12H18N2O3S2/c1-17-11(15)10(5-7-18-2)14-12(16)13-8-9-4-3-6-19-9/h3-4,6,10H,5,7-8H2,1-2H3,(H2,13,14,16)/t10-/m0/s1 |
| InChIKey | NYXUHNBVBSSVSF-JTQLQIEISA-N |
| XLogP | 1.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |