C9H10ClN5 — CID 539378
1-(4-chlorophenyl)-N,N-dimethyltetrazol-5-amine (PubChem CID 539378) has the molecular formula C9H10ClN5 and a molecular weight of 223.67 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N,N-dimethyltetrazol-5-amine.
| Compound Name | 1-(4-chlorophenyl)-N,N-dimethyltetrazol-5-amine |
|---|---|
| PubChem CID | 539378 |
| Molecular Formula | C9H10ClN5 |
| Molecular Weight | 223.67 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 1-(4-chlorophenyl)-N,N-dimethyltetrazol-5-amine |
| SMILES | CN(C)c1nnnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H10ClN5/c1-14(2)9-11-12-13-15(9)8-5-3-7(10)4-6-8/h3-6H,1-2H3 |
| InChIKey | QKPHBZZPOHBGLN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.67 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |