C13H7Cl3N4 — CID 2799603
1-(4-chlorophenyl)-5-(3,4-dichlorophenyl)tetrazole (PubChem CID 2799603) has the molecular formula C13H7Cl3N4 and a molecular weight of 325.59 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-(3,4-dichlorophenyl)tetrazole.
| Compound Name | 1-(4-chlorophenyl)-5-(3,4-dichlorophenyl)tetrazole |
|---|---|
| PubChem CID | 2799603 |
| Molecular Formula | C13H7Cl3N4 |
| Molecular Weight | 325.59 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 1-(4-chlorophenyl)-5-(3,4-dichlorophenyl)tetrazole |
| SMILES | Clc1ccc(-n2nnnc2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C13H7Cl3N4/c14-9-2-4-10(5-3-9)20-13(17-18-19-20)8-1-6-11(15)12(16)7-8/h1-7H |
| InChIKey | BWUCYRQUDXZMAM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |