C13H8Cl2FN5 — CID 62682445
4-[1-(3,5-dichlorophenyl)tetrazol-5-yl]-2-fluoroaniline (PubChem CID 62682445) has the molecular formula C13H8Cl2FN5 and a molecular weight of 324.15 g/mol. Its IUPAC name is 4-[1-(3,5-dichlorophenyl)tetrazol-5-yl]-2-fluoroaniline.
| Compound Name | 4-[1-(3,5-dichlorophenyl)tetrazol-5-yl]-2-fluoroaniline |
|---|---|
| PubChem CID | 62682445 |
| Molecular Formula | C13H8Cl2FN5 |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 4-[1-(3,5-dichlorophenyl)tetrazol-5-yl]-2-fluoroaniline |
| SMILES | Nc1ccc(-c2nnnn2-c2cc(Cl)cc(Cl)c2)cc1F |
| InChI | InChI=1S/C13H8Cl2FN5/c14-8-4-9(15)6-10(5-8)21-13(18-19-20-21)7-1-2-12(17)11(16)3-7/h1-6H,17H2 |
| InChIKey | LDXCGBMLCFSGFI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|