C17H16Cl2N4 — CID 2732064
5-(4-tert-butylphenyl)-1-(2,5-dichlorophenyl)tetrazole (PubChem CID 2732064) has the molecular formula C17H16Cl2N4 and a molecular weight of 347.25 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-1-(2,5-dichlorophenyl)tetrazole.
| Compound Name | 5-(4-tert-butylphenyl)-1-(2,5-dichlorophenyl)tetrazole |
|---|---|
| PubChem CID | 2732064 |
| Molecular Formula | C17H16Cl2N4 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 5-(4-tert-butylphenyl)-1-(2,5-dichlorophenyl)tetrazole |
| SMILES | CC(C)(C)c1ccc(-c2nnnn2-c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2N4/c1-17(2,3)12-6-4-11(5-7-12)16-20-21-22-23(16)15-10-13(18)8-9-14(15)19/h4-10H,1-3H3 |
| InChIKey | BYBUFJTZDMSGBI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |