C8H6BrNO3 — CID 5395404
(NZ)-N-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydroxylamine (PubChem CID 5395404) has the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. Its IUPAC name is (NZ)-N-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 5395404 |
| Molecular Formula | C8H6BrNO3 |
| Molecular Weight | 244.04 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | (NZ)-N-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]hydroxylamine |
| SMILES | O/N=C\c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C8H6BrNO3/c9-6-2-8-7(12-4-13-8)1-5(6)3-10-11/h1-3,11H,4H2/b10-3- |
| InChIKey | LDVWAWRHAYQDDA-KMKOMSMNSA-N |
| XLogP | 1.99 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.04 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|