C19H17NO3 — CID 53978559
(4S)-4-Benzyl-3-(3-phenylprop-2-enoyl)-1,3-oxazolidin-2-one (PubChem CID 53978559) has the molecular formula C19H17NO3 and a molecular weight of 307.30 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(3-phenylprop-2-enoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-Benzyl-3-(3-phenylprop-2-enoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 53978559 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (4S)-4-benzyl-3-(3-phenylprop-2-enoyl)-1,3-oxazolidin-2-one |
| SMILES | C1[C@@H](N(C(=O)O1)C(=O)C=CC2=CC=CC=C2)CC3=CC=CC=C3 |
| InChI | InChI=1S/C19H17NO3/c21-18(12-11-15-7-3-1-4-8-15)20-17(14-23-19(20)22)13-16-9-5-2-6-10-16/h1-12,17H,13-14H2/t17-/m0/s1 |
| InChIKey | JWRBSVRDVDBQOA-KRWDZBQOSA-N |
| XLogP | 3.80 |
| TPSA | 46.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 448 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|