C27H35NO4S2 — CID 54000243
3-(4-amino-2-cyclopentyl-5-methylphenyl)sulfanyl-6-[2-[4-(hydroxymethyl)thiophen-3-yl]ethyl]-6-propan-2-yloxane-2,4-dione (PubChem CID 54000243) has the molecular formula C27H35NO4S2 and a molecular weight of 501.71 g/mol. Its IUPAC name is 3-(4-amino-2-cyclopentyl-5-methylphenyl)sulfanyl-6-[2-[4-(hydroxymethyl)thiophen-3-yl]ethyl]-6-propan-2-yloxane-2,4-dione.
| Compound Name | 3-(4-amino-2-cyclopentyl-5-methylphenyl)sulfanyl-6-[2-[4-(hydroxymethyl)thiophen-3-yl]ethyl]-6-propan-2-yloxane-2,4-dione |
|---|---|
| PubChem CID | 54000243 |
| Molecular Formula | C27H35NO4S2 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 3-(4-amino-2-cyclopentyl-5-methylphenyl)sulfanyl-6-[2-[4-(hydroxymethyl)thiophen-3-yl]ethyl]-6-propan-2-yloxane-2,4-dione |
| SMILES | Cc1cc(SC2C(=O)CC(CCc3cscc3CO)(C(C)C)OC2=O)c(C2CCCC2)cc1N |
| InChI | InChI=1S/C27H35NO4S2/c1-16(2)27(9-8-19-14-33-15-20(19)13-29)12-23(30)25(26(31)32-27)34-24-10-17(3)22(28)11-21(24)18-6-4-5-7-18/h10-11,14-16,18,25,29H,4-9,12-13,28H2,1-3H3 |
| InChIKey | KLBGCZMDTRXMLR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|