C26H35NO3S2 — CID 54320370
3-(4-amino-2-tert-butyl-5-methylphenyl)sulfanyl-6-[2-(3-methylthiophen-2-yl)ethyl]-6-propan-2-yloxane-2,4-dione (PubChem CID 54320370) has the molecular formula C26H35NO3S2 and a molecular weight of 473.70 g/mol. Its IUPAC name is 3-(4-amino-2-tert-butyl-5-methylphenyl)sulfanyl-6-[2-(3-methylthiophen-2-yl)ethyl]-6-propan-2-yloxane-2,4-dione.
| Compound Name | 3-(4-amino-2-tert-butyl-5-methylphenyl)sulfanyl-6-[2-(3-methylthiophen-2-yl)ethyl]-6-propan-2-yloxane-2,4-dione |
|---|---|
| PubChem CID | 54320370 |
| Molecular Formula | C26H35NO3S2 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 3-(4-amino-2-tert-butyl-5-methylphenyl)sulfanyl-6-[2-(3-methylthiophen-2-yl)ethyl]-6-propan-2-yloxane-2,4-dione |
| SMILES | Cc1cc(SC2C(=O)CC(CCc3sccc3C)(C(C)C)OC2=O)c(C(C)(C)C)cc1N |
| InChI | InChI=1S/C26H35NO3S2/c1-15(2)26(10-8-21-16(3)9-11-31-21)14-20(28)23(24(29)30-26)32-22-12-17(4)19(27)13-18(22)25(5,6)7/h9,11-13,15,23H,8,10,14,27H2,1-7H3 |
| InChIKey | SRFKEQZBQXFAAG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|