C18H25NO3S — CID 10019866
3-(4-amino-2-tert-butyl-5-methylphenyl)sulfanyl-6,6-dimethyloxane-2,4-dione (PubChem CID 10019866) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 3-(4-amino-2-tert-butyl-5-methylphenyl)sulfanyl-6,6-dimethyloxane-2,4-dione.
| Compound Name | 3-(4-amino-2-tert-butyl-5-methylphenyl)sulfanyl-6,6-dimethyloxane-2,4-dione |
|---|---|
| PubChem CID | 10019866 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 3-(4-amino-2-tert-butyl-5-methylphenyl)sulfanyl-6,6-dimethyloxane-2,4-dione |
| SMILES | Cc1cc(SC2C(=O)CC(C)(C)OC2=O)c(C(C)(C)C)cc1N |
| InChI | InChI=1S/C18H25NO3S/c1-10-7-14(11(8-12(10)19)17(2,3)4)23-15-13(20)9-18(5,6)22-16(15)21/h7-8,15H,9,19H2,1-6H3 |
| InChIKey | GVXDBCOPCBKHAB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|