C26H37NO3S — CID 90840493
3-(4-amino-2-tert-butyl-5-methylphenyl)sulfanyl-6,6-dicyclopentyloxane-2,4-dione (PubChem CID 90840493) has the molecular formula C26H37NO3S and a molecular weight of 443.65 g/mol. Its IUPAC name is 3-(4-amino-2-tert-butyl-5-methylphenyl)sulfanyl-6,6-dicyclopentyloxane-2,4-dione.
| Compound Name | 3-(4-amino-2-tert-butyl-5-methylphenyl)sulfanyl-6,6-dicyclopentyloxane-2,4-dione |
|---|---|
| PubChem CID | 90840493 |
| Molecular Formula | C26H37NO3S |
| Molecular Weight | 443.65 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 3-(4-amino-2-tert-butyl-5-methylphenyl)sulfanyl-6,6-dicyclopentyloxane-2,4-dione |
| SMILES | Cc1cc(SC2C(=O)CC(C3CCCC3)(C3CCCC3)OC2=O)c(C(C)(C)C)cc1N |
| InChI | InChI=1S/C26H37NO3S/c1-16-13-22(19(14-20(16)27)25(2,3)4)31-23-21(28)15-26(30-24(23)29,17-9-5-6-10-17)18-11-7-8-12-18/h13-14,17-18,23H,5-12,15,27H2,1-4H3 |
| InChIKey | LBGIESHZJSSNKC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|