C23H33NO5S — CID 91274286
tert-butyl-[5-tert-butyl-4-(6,6-dimethyl-2,4-dioxooxan-3-yl)sulfanyl-2-methylphenyl]carbamic acid (PubChem CID 91274286) has the molecular formula C23H33NO5S and a molecular weight of 435.59 g/mol. Its IUPAC name is tert-butyl-[5-tert-butyl-4-(6,6-dimethyl-2,4-dioxooxan-3-yl)sulfanyl-2-methylphenyl]carbamic acid.
| Compound Name | tert-butyl-[5-tert-butyl-4-(6,6-dimethyl-2,4-dioxooxan-3-yl)sulfanyl-2-methylphenyl]carbamic acid |
|---|---|
| PubChem CID | 91274286 |
| Molecular Formula | C23H33NO5S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | tert-butyl-[5-tert-butyl-4-(6,6-dimethyl-2,4-dioxooxan-3-yl)sulfanyl-2-methylphenyl]carbamic acid |
| SMILES | Cc1cc(SC2C(=O)CC(C)(C)OC2=O)c(C(C)(C)C)cc1N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C23H33NO5S/c1-13-10-17(30-18-16(25)12-23(8,9)29-19(18)26)14(21(2,3)4)11-15(13)24(20(27)28)22(5,6)7/h10-11,18H,12H2,1-9H3,(H,27,28) |
| InChIKey | LPRQBSWEYXUPRW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|