C28H35NO3S2 — CID 54184533
(6S)-3-[(6-tert-butyl-2,3-dihydro-1H-indol-5-yl)sulfanyl]-6-propan-2-yl-6-[2-(3-sulfanylphenyl)ethyl]oxane-2,4-dione (PubChem CID 54184533) has the molecular formula C28H35NO3S2 and a molecular weight of 497.73 g/mol. Its IUPAC name is (6S)-3-[(6-tert-butyl-2,3-dihydro-1H-indol-5-yl)sulfanyl]-6-propan-2-yl-6-[2-(3-sulfanylphenyl)ethyl]oxane-2,4-dione.
| Compound Name | (6S)-3-[(6-tert-butyl-2,3-dihydro-1H-indol-5-yl)sulfanyl]-6-propan-2-yl-6-[2-(3-sulfanylphenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 54184533 |
| Molecular Formula | C28H35NO3S2 |
| Molecular Weight | 497.73 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | (6S)-3-[(6-tert-butyl-2,3-dihydro-1H-indol-5-yl)sulfanyl]-6-propan-2-yl-6-[2-(3-sulfanylphenyl)ethyl]oxane-2,4-dione |
| SMILES | CC(C)[C@]1(CCc2cccc(S)c2)CC(=O)C(Sc2cc3c(cc2C(C)(C)C)NCC3)C(=O)O1 |
| InChI | InChI=1S/C28H35NO3S2/c1-17(2)28(11-9-18-7-6-8-20(33)13-18)16-23(30)25(26(31)32-28)34-24-14-19-10-12-29-22(19)15-21(24)27(3,4)5/h6-8,13-15,17,25,29,33H,9-12,16H2,1-5H3/t25?,28-/m0/s1 |
| InChIKey | PEDYUEMXKZVKKL-NMXAJACMSA-N |
| XLogP | 6.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.73 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|