C28H34FNO3S — CID 54061226
3-[(6-tert-butyl-2,3-dihydro-1H-indol-5-yl)sulfanyl]-6-[2-(4-fluorophenyl)ethyl]-6-propan-2-yloxane-2,4-dione (PubChem CID 54061226) has the molecular formula C28H34FNO3S and a molecular weight of 483.65 g/mol. Its IUPAC name is 3-[(6-tert-butyl-2,3-dihydro-1H-indol-5-yl)sulfanyl]-6-[2-(4-fluorophenyl)ethyl]-6-propan-2-yloxane-2,4-dione.
| Compound Name | 3-[(6-tert-butyl-2,3-dihydro-1H-indol-5-yl)sulfanyl]-6-[2-(4-fluorophenyl)ethyl]-6-propan-2-yloxane-2,4-dione |
|---|---|
| PubChem CID | 54061226 |
| Molecular Formula | C28H34FNO3S |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 3-[(6-tert-butyl-2,3-dihydro-1H-indol-5-yl)sulfanyl]-6-[2-(4-fluorophenyl)ethyl]-6-propan-2-yloxane-2,4-dione |
| SMILES | CC(C)C1(CCc2ccc(F)cc2)CC(=O)C(Sc2cc3c(cc2C(C)(C)C)NCC3)C(=O)O1 |
| InChI | InChI=1S/C28H34FNO3S/c1-17(2)28(12-10-18-6-8-20(29)9-7-18)16-23(31)25(26(32)33-28)34-24-14-19-11-13-30-22(19)15-21(24)27(3,4)5/h6-9,14-15,17,25,30H,10-13,16H2,1-5H3 |
| InChIKey | LZVNKDTYSOCCCB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|