C24H23NO2S — CID 54001763
3-(1,3-benzothiazol-2-yl)-9-ethyl-6,6-dimethyl-8,9-dihydro-7H-benzo[g]chromen-2-one (PubChem CID 54001763) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-9-ethyl-6,6-dimethyl-8,9-dihydro-7H-benzo[g]chromen-2-one.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-9-ethyl-6,6-dimethyl-8,9-dihydro-7H-benzo[g]chromen-2-one |
|---|---|
| PubChem CID | 54001763 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-9-ethyl-6,6-dimethyl-8,9-dihydro-7H-benzo[g]chromen-2-one |
| SMILES | CCC1CCC(C)(C)c2cc3cc(-c4nc5ccccc5s4)c(=O)oc3cc21 |
| InChI | InChI=1S/C24H23NO2S/c1-4-14-9-10-24(2,3)18-12-15-11-17(23(26)27-20(15)13-16(14)18)22-25-19-7-5-6-8-21(19)28-22/h5-8,11-14H,4,9-10H2,1-3H3 |
| InChIKey | KMCSLWXDEIDYFS-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|