C24H36N3O5P — CID 54001803
benzyl (2R)-1-[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]-2-diethylphosphorylpyrrolidine-2-carboxylate (PubChem CID 54001803) has the molecular formula C24H36N3O5P and a molecular weight of 477.54 g/mol. Its IUPAC name is benzyl (2R)-1-[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]-2-diethylphosphorylpyrrolidine-2-carboxylate.
| Compound Name | benzyl (2R)-1-[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]-2-diethylphosphorylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 54001803 |
| Molecular Formula | C24H36N3O5P |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | benzyl (2R)-1-[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]-2-diethylphosphorylpyrrolidine-2-carboxylate |
| SMILES | CCP(=O)(CC)[C@@]1(C(=O)OCc2ccccc2)CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](C)N |
| InChI | InChI=1S/C24H36N3O5P/c1-4-33(31,5-2)24(23(30)32-17-19-11-7-6-8-12-19)14-10-16-27(24)22(29)20-13-9-15-26(20)21(28)18(3)25/h6-8,11-12,18,20H,4-5,9-10,13-17,25H2,1-3H3/t18-,20-,24+/m0/s1 |
| InChIKey | KMDIBCBVRZCNCT-VAXXYWNWSA-N |
| XLogP | 2.79 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|