C8H15NO4S — CID 54003546
2-[[(E)-but-2-enyl]sulfinyloxy-methylamino]propanoic acid (PubChem CID 54003546) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-[[(E)-but-2-enyl]sulfinyloxy-methylamino]propanoic acid.
| Compound Name | 2-[[(E)-but-2-enyl]sulfinyloxy-methylamino]propanoic acid |
|---|---|
| PubChem CID | 54003546 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-[[(E)-but-2-enyl]sulfinyloxy-methylamino]propanoic acid |
| SMILES | C/C=C/CS(=O)ON(C)C(C)C(=O)O |
| InChI | InChI=1S/C8H15NO4S/c1-4-5-6-14(12)13-9(3)7(2)8(10)11/h4-5,7H,6H2,1-3H3,(H,10,11)/b5-4+ |
| InChIKey | BFYIFQCGEUGMSG-SNAWJCMRSA-N |
| XLogP | 0.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|