C13H26O4SSi — CID 10979709
trimethylsilyl (Z,4S,5R)-4-methoxy-5-methyl-6-oxooct-2-ene-1-sulfinate (PubChem CID 10979709) has the molecular formula C13H26O4SSi and a molecular weight of 306.50 g/mol. Its IUPAC name is trimethylsilyl (Z,4S,5R)-4-methoxy-5-methyl-6-oxooct-2-ene-1-sulfinate.
| Compound Name | trimethylsilyl (Z,4S,5R)-4-methoxy-5-methyl-6-oxooct-2-ene-1-sulfinate |
|---|---|
| PubChem CID | 10979709 |
| Molecular Formula | C13H26O4SSi |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | trimethylsilyl (Z,4S,5R)-4-methoxy-5-methyl-6-oxooct-2-ene-1-sulfinate |
| SMILES | CCC(=O)[C@H](C)[C@H](/C=C\CS(=O)O[Si](C)(C)C)OC |
| InChI | InChI=1S/C13H26O4SSi/c1-7-12(14)11(2)13(16-3)9-8-10-18(15)17-19(4,5)6/h8-9,11,13H,7,10H2,1-6H3/b9-8-/t11-,13-,18?/m0/s1 |
| InChIKey | ZHGNVXUETBAVTQ-DBFPGJADSA-N |
| XLogP | 2.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|