C13H20N2O2 — CID 54003653
2-piperidin-4-yl-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 54003653) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-piperidin-4-yl-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-piperidin-4-yl-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54003653 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-piperidin-4-yl-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1C1CCNCC1)CCCC2 |
| InChI | InChI=1S/C13H20N2O2/c16-12-10-3-1-2-4-11(10)13(17)15(12)9-5-7-14-8-6-9/h9,14,16-17H,1-8H2 |
| InChIKey | KNISSPXKQOJFDJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |