C12H22O3 — CID 54006692
3-hydroxy-2,2-dimethyl-4-propylhept-5-enoic acid (PubChem CID 54006692) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyl-4-propylhept-5-enoic acid.
| Compound Name | 3-hydroxy-2,2-dimethyl-4-propylhept-5-enoic acid |
|---|---|
| PubChem CID | 54006692 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 3-hydroxy-2,2-dimethyl-4-propylhept-5-enoic acid |
| SMILES | CC=CC(CCC)C(O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H22O3/c1-5-7-9(8-6-2)10(13)12(3,4)11(14)15/h5,7,9-10,13H,6,8H2,1-4H3,(H,14,15) |
| InChIKey | KPJNTZUHRHLFSP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|