C11H13NO3 — CID 54007112
2-(oxiran-2-ylmethyl)-4,7-dihydroisoindole-1,3-diol (PubChem CID 54007112) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethyl)-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-(oxiran-2-ylmethyl)-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54007112 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-(oxiran-2-ylmethyl)-4,7-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CC1CO1)CC=CC2 |
| InChI | InChI=1S/C11H13NO3/c13-10-8-3-1-2-4-9(8)11(14)12(10)5-7-6-15-7/h1-2,7,13-14H,3-6H2 |
| InChIKey | KPRDNSKINNNDRA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|