C14H10N4O3 — CID 54007806
3-amino-4-[3-(1H-imidazole-5-carbonyl)anilino]cyclobut-3-ene-1,2-dione (PubChem CID 54007806) has the molecular formula C14H10N4O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is 3-amino-4-[3-(1H-imidazole-5-carbonyl)anilino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[3-(1H-imidazole-5-carbonyl)anilino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 54007806 |
| Molecular Formula | C14H10N4O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-amino-4-[3-(1H-imidazole-5-carbonyl)anilino]cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(Nc2cccc(C(=O)c3cnc[nH]3)c2)c(=O)c1=O |
| InChI | InChI=1S/C14H10N4O3/c15-10-11(14(21)13(10)20)18-8-3-1-2-7(4-8)12(19)9-5-16-6-17-9/h1-6,18H,15H2,(H,16,17) |
| InChIKey | KQCVVYACWMSZCP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|