C12H24N3O4PS3 — CID 54007839
methyl N-[[(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)-ethylamino]sulfanyl-methylcarbamoyl]oxyethanimidothioate (PubChem CID 54007839) has the molecular formula C12H24N3O4PS3 and a molecular weight of 401.52 g/mol. Its IUPAC name is methyl N-[[(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)-ethylamino]sulfanyl-methylcarbamoyl]oxyethanimidothioate.
| Compound Name | methyl N-[[(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)-ethylamino]sulfanyl-methylcarbamoyl]oxyethanimidothioate |
|---|---|
| PubChem CID | 54007839 |
| Molecular Formula | C12H24N3O4PS3 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | methyl N-[[(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)-ethylamino]sulfanyl-methylcarbamoyl]oxyethanimidothioate |
| SMILES | CCN(SN(C)C(=O)ON=C(C)SC)P1(=S)OCC(C)(C)CO1 |
| InChI | InChI=1S/C12H24N3O4PS3/c1-7-15(20(21)17-8-12(3,4)9-18-20)23-14(5)11(16)19-13-10(2)22-6/h7-9H2,1-6H3 |
| InChIKey | KQDQLYOQGHIENQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|