C15H12N2O4 — CID 54008766
furan-2-ylmethyl N-[1-(3-cyanophenyl)-2-oxoethyl]carbamate (PubChem CID 54008766) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is furan-2-ylmethyl N-[1-(3-cyanophenyl)-2-oxoethyl]carbamate.
| Compound Name | furan-2-ylmethyl N-[1-(3-cyanophenyl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 54008766 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | furan-2-ylmethyl N-[1-(3-cyanophenyl)-2-oxoethyl]carbamate |
| SMILES | N#Cc1cccc(C(C=O)NC(=O)OCc2ccco2)c1 |
| InChI | InChI=1S/C15H12N2O4/c16-8-11-3-1-4-12(7-11)14(9-18)17-15(19)21-10-13-5-2-6-20-13/h1-7,9,14H,10H2,(H,17,19) |
| InChIKey | BVTPHWOJJJHXFD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|