C16H26O5 — CID 54009040
2-cyclohexylperoxycarbonyl-4,5-dimethylcyclohexane-1-carboxylic acid (PubChem CID 54009040) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-cyclohexylperoxycarbonyl-4,5-dimethylcyclohexane-1-carboxylic acid.
| Compound Name | 2-cyclohexylperoxycarbonyl-4,5-dimethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 54009040 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-cyclohexylperoxycarbonyl-4,5-dimethylcyclohexane-1-carboxylic acid |
| SMILES | CC1CC(C(=O)O)C(C(=O)OOC2CCCCC2)CC1C |
| InChI | InChI=1S/C16H26O5/c1-10-8-13(15(17)18)14(9-11(10)2)16(19)21-20-12-6-4-3-5-7-12/h10-14H,3-9H2,1-2H3,(H,17,18) |
| InChIKey | KQZMMWCRDGPPKN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|