C5H7NOS2 — CID 54009528
3-ethyl-4-hydroxy-1,3-thiazole-2-thione (PubChem CID 54009528) has the molecular formula C5H7NOS2 and a molecular weight of 161.25 g/mol. Its IUPAC name is 3-ethyl-4-hydroxy-1,3-thiazole-2-thione.
| Compound Name | 3-ethyl-4-hydroxy-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 54009528 |
| Molecular Formula | C5H7NOS2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.00 |
| IUPAC Name | 3-ethyl-4-hydroxy-1,3-thiazole-2-thione |
| SMILES | CCn1c(O)csc1=S |
| InChI | InChI=1S/C5H7NOS2/c1-2-6-4(7)3-9-5(6)8/h3,7H,2H2,1H3 |
| InChIKey | KRHRHJUZFLYHLX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|