About 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione
4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione (PubChem CID 91227797) has the molecular formula C6H9NOS2
and a molecular weight of 175.28 g/mol. Its IUPAC name is 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione |
| PubChem CID | 91227797 |
| Molecular Formula | C6H9NOS2 |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.01 |
| IUPAC Name | 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione |
| SMILES | CC(C)n1c(O)csc1=S |
| InChI | InChI=1S/C6H9NOS2/c1-4(2)7-5(8)3-10-6(7)9/h3-4,8H,1-2H3 |
| InChIKey | BMUIBGCXIPQSKQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione?
The IUPAC name of 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione (CID 91227797) is 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione.
What is the SMILES notation for 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione?
The canonical SMILES for 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione is CC(C)n1c(O)csc1=S.
What is the InChIKey of 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione?
The InChIKey is BMUIBGCXIPQSKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NOS2/c1-4(2)7-5(8)3-10-6(7)9/h3-4,8H,1-2H3.
What are the key properties of 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione?
4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione has a molecular weight of 175.28 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-propan-2-yl-1,3-thiazole-2-thione is sourced from PubChem (CID 91227797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).