C4H6NOS2+ — CID 143254972
(3-methyl-2-sulfanylidene-1,3-thiazol-4-yl)oxidanium (PubChem CID 143254972) has the molecular formula C4H6NOS2+ and a molecular weight of 148.23 g/mol. Its IUPAC name is (3-methyl-2-sulfanylidene-1,3-thiazol-4-yl)oxidanium.
| Compound Name | (3-methyl-2-sulfanylidene-1,3-thiazol-4-yl)oxidanium |
|---|---|
| PubChem CID | 143254972 |
| Molecular Formula | C4H6NOS2+ |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 147.99 |
| IUPAC Name | (3-methyl-2-sulfanylidene-1,3-thiazol-4-yl)oxidanium |
| SMILES | Cn1c([OH2+])csc1=S |
| InChI | InChI=1S/C4H5NOS2/c1-5-3(6)2-8-4(5)7/h2,6H,1H3/p+1 |
| InChIKey | QIAPSDBJCUHEQG-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 27.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|