C15H21N — CID 54011888
1-cyclohexyl-2-methyl-2,3-dihydroindole (PubChem CID 54011888) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-cyclohexyl-2-methyl-2,3-dihydroindole.
| Compound Name | 1-cyclohexyl-2-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 54011888 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-cyclohexyl-2-methyl-2,3-dihydroindole |
| SMILES | CC1Cc2ccccc2N1C1CCCCC1 |
| InChI | InChI=1S/C15H21N/c1-12-11-13-7-5-6-10-15(13)16(12)14-8-3-2-4-9-14/h5-7,10,12,14H,2-4,8-9,11H2,1H3 |
| InChIKey | KSXZZWPWISQLSM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |