C23H32N2O6 — CID 54013620
2,2-bis[2-amino-4-(2,2-dimethoxyethyl)phenyl]propanoic acid (PubChem CID 54013620) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2,2-bis[2-amino-4-(2,2-dimethoxyethyl)phenyl]propanoic acid.
| Compound Name | 2,2-bis[2-amino-4-(2,2-dimethoxyethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 54013620 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2,2-bis[2-amino-4-(2,2-dimethoxyethyl)phenyl]propanoic acid |
| SMILES | COC(Cc1ccc(C(C)(C(=O)O)c2ccc(CC(OC)OC)cc2N)c(N)c1)OC |
| InChI | InChI=1S/C23H32N2O6/c1-23(22(26)27,16-8-6-14(10-18(16)24)12-20(28-2)29-3)17-9-7-15(11-19(17)25)13-21(30-4)31-5/h6-11,20-21H,12-13,24-25H2,1-5H3,(H,26,27) |
| InChIKey | KUBSSMSTFLVUNK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|