C8BrF15 — CID 54014587
1-bromo-1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorocyclooctane (PubChem CID 54014587) has the molecular formula C8BrF15 and a molecular weight of 460.96 g/mol. Its IUPAC name is 1-bromo-1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorocyclooctane.
| Compound Name | 1-bromo-1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorocyclooctane |
|---|---|
| PubChem CID | 54014587 |
| Molecular Formula | C8BrF15 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 459.89 |
| IUPAC Name | 1-bromo-1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorocyclooctane |
| SMILES | FC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(Br)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8BrF15/c9-1(10)2(11,12)4(15,16)6(19,20)8(23,24)7(21,22)5(17,18)3(1,13)14 |
| InChIKey | KUSMROKTQDRBNC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|