C24H19N3O4S — CID 54016208
N-[1-[(3-cyanophenyl)methyl]-5-oxopyrrolidin-3-yl]dibenzofuran-2-sulfonamide (PubChem CID 54016208) has the molecular formula C24H19N3O4S and a molecular weight of 445.50 g/mol. Its IUPAC name is N-[1-[(3-cyanophenyl)methyl]-5-oxopyrrolidin-3-yl]dibenzofuran-2-sulfonamide.
| Compound Name | N-[1-[(3-cyanophenyl)methyl]-5-oxopyrrolidin-3-yl]dibenzofuran-2-sulfonamide |
|---|---|
| PubChem CID | 54016208 |
| Molecular Formula | C24H19N3O4S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-[1-[(3-cyanophenyl)methyl]-5-oxopyrrolidin-3-yl]dibenzofuran-2-sulfonamide |
| SMILES | N#Cc1cccc(CN2CC(NS(=O)(=O)c3ccc4oc5ccccc5c4c3)CC2=O)c1 |
| InChI | InChI=1S/C24H19N3O4S/c25-13-16-4-3-5-17(10-16)14-27-15-18(11-24(27)28)26-32(29,30)19-8-9-23-21(12-19)20-6-1-2-7-22(20)31-23/h1-10,12,18,26H,11,14-15H2 |
| InChIKey | KVUMTOFGJNTJNN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |