C23H21N3O3S — CID 54070623
N-[1-[(3-cyanophenyl)methyl]-2-oxopiperidin-3-yl]naphthalene-2-sulfonamide (PubChem CID 54070623) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[1-[(3-cyanophenyl)methyl]-2-oxopiperidin-3-yl]naphthalene-2-sulfonamide.
| Compound Name | N-[1-[(3-cyanophenyl)methyl]-2-oxopiperidin-3-yl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 54070623 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[1-[(3-cyanophenyl)methyl]-2-oxopiperidin-3-yl]naphthalene-2-sulfonamide |
| SMILES | N#Cc1cccc(CN2CCCC(NS(=O)(=O)c3ccc4ccccc4c3)C2=O)c1 |
| InChI | InChI=1S/C23H21N3O3S/c24-15-17-5-3-6-18(13-17)16-26-12-4-9-22(23(26)27)25-30(28,29)21-11-10-19-7-1-2-8-20(19)14-21/h1-3,5-8,10-11,13-14,22,25H,4,9,12,16H2 |
| InChIKey | MGECWACBPMUSOO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |